a) Circle the correct answer for each of the following questions
I) what is meant by aliphatic hydrocarbon
a. it contains at least one aromatic ring
b. it contains only carbon and hydrogen atoms, with straight or branched chain.
c. it contains double bond between carbon atoms only.
d. it contains at least one oxygen atom.
ii)which property of carbon allows it to bond to itself and form long chain of compounds.
a. Electronegativity
b. Hybridization
c. Bonding strength
d. Catenation
iii)which of the following compound is alicyclic hydrocarbon.
a. Cyclohexane
b. Benzene
c. n-hexane
d. cyclohexene
2. this question concerns the following oxides Al2O3, Na2O, SiO2, SO2 from the list above identify the
oxides that best fits the description given below.
I) An oxide which has a giant covalent structure…………………….
ii) An oxide that react with water forming a strongly alkaline solution ………………….
iii) An oxide which is neither acidic or basic…………………….
iv) An oxide that behaves as both acid and base……………….
v) An oxide that react with water forming an acidic solution…………………
[Link] a letter of the correct answer for each of the following questions.
I. What is the shape of boron trichloride (BCl3)
a) Tetrahedral
b) Trigonal planar
c) Linear
d) Octahedral
II. What is the balance equation for each of the following question.
a) Al3+(Aq)+6H2O(l) [Al(H2O)5(OH)]2+(Aq)+H3O3+(Aq)
3+
b) Al (Aq)+6H2O(l) [Al(H2O)3(OH)]+(Aq)+OH-(Aq)
c) Al3+(Aq)+5H2O(l) [Al(OH)]2+(Aq)+H3o+(Aq)
d) Al3+(Aq)+6H2O(l) [Al(OH)6]3+(Aq)+H3O+(Aq)
III. which of the following are the two(2) correct uses of aluminium metal.
a) Making electric cables
b) Making magnet materials
c) Making body aircrafts
d) Manufacture of heavy equipment like bulldosers
4) Given two complexes x and y of cobalt x=[Co(NH3)5Br]SO4 and y=[Co(NH3)5SO4]Br
I. what is the systematic IUPAC name for the compound x
a) Pentaamminebromocobalt(II)sulphate
b) Pentaamminedibromocobalt(III)sulphate
c) Pentaamminetribromocobalt(III)sulphate
d) Pentaamminebromocobalt(III)sulphate
ii. what are the shape name and coordination number for y
a) Tetrahedral and 5
b) Octahedral and 6
c) Octahedral and 4
d) Square planar and 6
iii. what ions are released when y is dissolved in water (H2O) according to the following reaction .
a) [Co(NH3)(H2O)]3+(Aq) and Br-(Aq)
b) [Co(NH3)5SO4]+(Aq) and Br-(Aq)
c) [[Co3+(Aq), NH3(Aq), SO42-(Aq) and Br-(Aq)
d) [CO(NH3)5]3+(Aq) and Br-(Aq)
5) Ammonia (NH3) reacts with water (H2O) according to the following reaction:
NH3(Aq)+H2O(l) NH4+(Aq)+OH-(Aq)
I. Which of the species in the above reaction is:
a) a Lewis acid?
b) A Lewis base?
II. Match the species in the left column with its corresponding bond angle in the light
column of the table below
SN Species SN Bond angle
A) H2O (1) 109.5
B) NH3 (2) 107
C) NH4+ (3) 104.5
6. circle the letter of collect answer for each of the following questions
[Link] order to be suitable for aprimary standard, a compound must be all of the following EXCEPT one of
the following;
A. readily available and inexipensive
B. very pure analytically reagent grade(about 99.9%).
C. insoluble in solvent used and under the condition used.
D. unaltered in air during weighting.
ii. in the titration, when does equivalence point said to have been mate
A. When number of equivalent/moles for the titrants equals the number of equivalents/moles of
the analyte.
B. When the number of equivalents / moles for the titrants solution becomes low.
C. When indicator changes color.
D. When the volume of titrant added equals the volume of the solution being titrated
iii. A specialized analytic use of acid-base titration to determine the concentration of acid solution is
known as
A. Alkalimetry
B. Calorimetry
C. Acidimetry
D. Spectrometry
iv. The most suitable acid for acidifying the reaction medium between KMnO4 and Fe2+(aq) is;
A. Ethanoic acid since it can provide low concetration of H+ ions
B. Nitric acid since it is powerful oxidant and can react
C. Hydrochloric acid since it oxidese to chlorine gas during reaction
D. Sulphuric acid since it is neither oxidized nor reduced during reaction
7. consider the reversible reactioo between methane and hydrogen sulphide
CH4(g) + 2H2s(g) 4H2+ CS2 DH is 233kj mol-1
i. For the above system at equilibrium
a. When the temperature is raised, the equilibrium position shifts from left to the right
TRUE/FALSE
b. ………………………………………………………………..
c. When the number of moles of H2S is increased, the equilibrium position shifts from left to right
ii. The expression of KP in function of Kc , for the above rection is
[Link]=Kc(RT)-1
B. Kp=Kc(RT)1
C. Kp=Kc(RT)+2
D. Kp=Kc(RT)-2
8. Match each equation in the left column with its corresponding type of organic reaction in the right
column of the table.
SN Equation SN Type of reaction
i. CH4+Cl2 UV Ligth CH3Cl + HCl A. Nucleophilic
addition
ii. CH3CHO + CH3CH2MgBr H2O CH3CH[OH]CH2CH3 + Mg(OH)Br B. Radicalar addition
iii. CH3CH=CH2 + HBr HOOH CH3CHCLCH2Br C. Electrophilic
substitution
iv. CH3CH=CH2 +HCL CH3CHCLCH3 D. Radicalar
substitution
v. C6H6 30 C-60 C CONC. HNO3/H2SO2C6H5NO2 + H2O E. Electrophilic
addition
9. Given the bond enthalpies/ bond energies in the table below.
Bond Average Bond Enthalpy (kj/mol)
C-C 348
C-H 412
C-O 358
O=O 498
C=O(IN CO2) 805
O-H 465
i. What is the enthalpy change(DHrx) for the reaction?
CH4+2O2 CO2 + 2H2O
-1
A. +962 KJ Mol
B. +792 KJ Mol-1
C. -2644 KJ Mol-1
D. -926 KJ Mol-1
ii. For the reaction of hydration of ethane
CH2=CH2 (g) + H2O(g) CH3CH2OH(l) DH=-42 KJMol-1
What is the average bond energy for the bond C-C?
A.
-305 KJMol-1
B. +1583 KMol-1
C. +611 KJMol-1
D. -507 KJMol-1
10. the nuclear fusion is a reaction known to occur in sun and other stars.
i. what is meant by nuclear fusion
A. The process of splitting heavy nucleus into lighter nuclei, realizing energy.
B. A reaction where electrons are transeferred between atoms, forming ions
C. the process of combining two light atomic nuclei to form a relatively heavier nucleus, realizing energy
D. A chemical reaction involving the rearrangement of atoms, without changing nuclei.
ii. what are the values for P and q in the following equation?
HCL + 10n p
qx + 11H
A. P= 35 and q=16
B. P=37 and q=15
C. P=38 and q=17
D. P=35 and q=15
iii. What are value for r and s in the following equations?
1
2Li + 11H r
pY + 10n
A. R=7 and s=3
B. R=7 and s=4
C. R=9 and s=3
D. R=8 and s=4
11. Answer with true or false each of the following statements.
I. ethanoic acid (CHOOH) is a stronger than ethanoic acid (CH3COOH)…………….
II. Chloroethanoic acid (Cl-CH2COOH) is weaker than ethanoic acid (CH3COOH)……………..
[Link] boiling point of butan-1-ol(CH3CH2CH2CH2OH) is lower than that of CH3C(CH3)OH-CH3 (2-
methyl propan-2-ol)………….
[Link] trifluoride (BF3) acts as a Lewis acid ……......
[Link] ion (CH4+) as bronsted Lowery base…………….
12. The PH of lemon juice is approximately equal to 2.6.
i. What is mathematical expression of Ph.
A. pH=-log[OH-]
B. PH=-log[H2O]
C. pH=-log[H+]
D. pH=log[H+]
ii. what is the concentration of hydrogen ion in the lemon juice?
A. 2.51x10-5M
B. 2.51X10-3M
C. 0.51X10-3M
D. 1.51X10-3M
iii. What is the concentration of hydroxide ions [OH-] in the lemon juice?
A. 3.98x10-12M
B. 1.14x10-2M
C. 9.38x10-12M
D. 1.12x10-10M
13) The following figure depicts a Maxwell-Boltzmann distribution curve for a gas.
a) Define the term “activation energy”?
b) Explain the effect of temperature on the rate of the reaction
c) Copy the above curve and on the same axes, draw a second curve that would show the same
volume of the same gas at a higher temperature, T2.
14) The nature of a substituent already present on benzene ring determines the position of the next
incoming group.
a) Give the systematic IUPAC name for the compound E in (ii) bellow.
b) Identify the necessary reagent and condition(s) for the conversion of E into F.
CH2Cl CH2OH
c) Predict each of the following aromatic compounds which substituent group entered
first. Give the reason for of your answer.
I. O2N OH
CHO
II.
CH3
Answer for question 13………..………………………………………………………………………………………………………………………………..
……………………………………………………………………………………………………………………………………………………………………………….
……………………………………………………………………………………………………………………………………………………………………………….
………………………………………………………………………………………………………………………………………………………………………………
………………………………………………………………………………………………………………………………………………………………………………
SECTION B: Attempt (3) questions (30 marks)
15) An electron in a given orbital is described by a set of certain numbers called quantum number of an
element G has it outermost electron which is defined by four (4) quantum number as follows:
n=3, l=1, mL=0 and ms=+1/2
i. What is meant by quantum numbers in atomic theory?
A. Number used to balance chemical equations
B. Number used to describe the size, shape, and orientation of orbitals, as well as the
spin of the electrons.
C. Number that indicates the number of protons in atoms.
ii. Which of the following is the correct outermost subshell, for the atom G?
A. 4s2:
B. 3p2:
C. 4s1:
D. 3d6:
III. What is the correct electron configuration for this atom of electron G in term of s, p, d, f
notation?
A. 1s22s22p63s23p24s23d6
B. 1s22s22p63s23p64s1
C. 1s22s22p63s23p64s2
D. 1s22s22p63s23p2
IV. How many total electrons does the atom G contain?
A. 14 electrons
B. 19 electrons
C. 20 electrons
D. 26 electrons
V. What is the correct set of period, group, and block for G?
A. Period=4, group=8, and block=d
B. Period=4, group=1, and block=s
C. Period=3, group=4, and block=p
D. Period=4, group=4, and block=s
VI. What is the compound that would be formed between G and hydrogen?
(atomic number of H=1)
A. GH4
B. GH
C. GH3
D. GH2
16) Consider the following sequence of reaction and answer the question that follow,
O
X
CH3-CH2-C-O-CH3 C2H5COOH + J PCl5 k NH3 L
SOCl2 Reflux
C2H5COOH Z N NaNO2 C3H7NH2 y M
i 0-50C
A. Name the compound H.
B. Suggest the reagent and condition represented with X.
C. Give the structural formula and name for J.
D. Give the structural formula for the compound k, L, M, and N.
E. State the reagent and conditions represented with y and z.
17) A buffer solution, H3PO4/ has a PH=2 and it contains 0.1 moldm-3 phosphoric acid (H3PO4). (pka for
H3PO4/H2PO4-) =2.1
A. What is meant by the term “buffer solution”
i. A solution that speeds up the chemical reactions without being consumed.
ii. A solution which is composed by a weak acid or weak base and its salts of strong base or strong
acid.
iii. A solution only water and neutral salt.
iv. A solution which is composed by strong acid and strong base and its salt of weak base or weak
acid.
B. Which of the following is a correct example of basic buffer system
I. HCl/NaCl
II. HCN/NaCN
III. CH3NH3Cl/CH3NH2
IV. CH2COOH/CH3COOHNa
C. What is the concentration of the salt (NaH2PO4) in the above buffer?
i. [Link]-3
ii. [Link]-3
iii. [Link]-3
iv. [Link]-3
D. The phosphate buffer system H2PO4-/HPO42- is known to regulate the PH change in intracellular fluids and
in the kidney. Using relevant equations, explain how this buffer react:
i. When a small amount of hydrochloric acid (HCl) solution is added .
ii. When a small amount of sodium hydroxide (NaOH)solution is added.
18) This question concerns the chlorides of some elements of the third period of the periodic table from sodium to
phosphorus. The melting point of these chlorides are given in the table below:
Compounds NaCl MgCl2 AlCl3 SiCl4 PCl5 S2Cl2
Melting point/ K 1081 987 451* 203 435 410
Bonding
*Sublimes at 4510K
1. Copy and complete the row of bonding using the term ionic, ionic with covalence or covalent
2. Give the balanced equation, with state symbols, for the reaction of phosphorus with chlorine to
form phosphorus (V)chloride, PCl5.
3. Why does phosphorus pentachloride (PCL5) have a higher melting point than disulphur dichloride
(S2Cl2)? (Atomic mass: P=31, Cl=35.5, S=32)
i. PCl5 has a higher molar mass and stronger van-der-wall forces than S2Cl2.
ii. PCl5 is an ionic solid while, S2Cl2 is a covalent molecular compound.
iii. PCl5 forms stronger hydrogen bonds than S2Cl2
iv. S2Cl2 is a metallic compound, whereas PCl5 is non-metallic.
4. The solution of sodium chloride is neutral, with PH=7,
True/false. Justify your answer.
5. The solution of ammonium chloride (NH3Cl) is basic, with a PH 7.
19) The initial rate of the reaction between substances P and Q was measured in a series of experiment and the
following rate equation was deduced:
Rate=K[P]2[Q]1
Experiment Initial [P][Link]-3 Initial [P] [Link]-3 Initial rate [Link]-3S-1
1 0.20 0.30 4.8x10-3
2 0.10 0.10 Z
3 0.40 Y 9.6x10-3
3 X 0.60 19.2x10-3
I. What is the partial order of the above reaction with respect to p?
II. Using the data from the above table, calculate the value of the rate constant, and deduce its units.
III. Find the value of X, Y, and Z in the table.
IV. Suggest any change in the reaction condition that will cause the value of rate constant to change
c